C18H16ClFN4OS — CID 172630085
N-[3-aminosulfanyl-5-(1-methylpyrazol-4-yl)phenyl]-2-(2-chloro-3-fluorophenyl)acetamide (PubChem CID 172630085) has the molecular formula C18H16ClFN4OS and a molecular weight of 390.87 g/mol. Its IUPAC name is N-[3-aminosulfanyl-5-(1-methylpyrazol-4-yl)phenyl]-2-(2-chloro-3-fluorophenyl)acetamide.
| Compound Name | N-[3-aminosulfanyl-5-(1-methylpyrazol-4-yl)phenyl]-2-(2-chloro-3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 172630085 |
| Molecular Formula | C18H16ClFN4OS |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N-[3-aminosulfanyl-5-(1-methylpyrazol-4-yl)phenyl]-2-(2-chloro-3-fluorophenyl)acetamide |
| SMILES | Cn1cc(-c2cc(NC(=O)Cc3cccc(F)c3Cl)cc(SN)c2)cn1 |
| InChI | InChI=1S/C18H16ClFN4OS/c1-24-10-13(9-22-24)12-5-14(8-15(6-12)26-21)23-17(25)7-11-3-2-4-16(20)18(11)19/h2-6,8-10H,7,21H2,1H3,(H,23,25) |
| InChIKey | WIQBDONBHYLGCD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|