C17H17N5OS — CID 172630072
N-[3-aminosulfanyl-5-(1-methylpyrazol-4-yl)phenyl]-2-pyridin-2-ylacetamide (PubChem CID 172630072) has the molecular formula C17H17N5OS and a molecular weight of 339.42 g/mol. Its IUPAC name is N-[3-aminosulfanyl-5-(1-methylpyrazol-4-yl)phenyl]-2-pyridin-2-ylacetamide.
| Compound Name | N-[3-aminosulfanyl-5-(1-methylpyrazol-4-yl)phenyl]-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 172630072 |
| Molecular Formula | C17H17N5OS |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-[3-aminosulfanyl-5-(1-methylpyrazol-4-yl)phenyl]-2-pyridin-2-ylacetamide |
| SMILES | Cn1cc(-c2cc(NC(=O)Cc3ccccn3)cc(SN)c2)cn1 |
| InChI | InChI=1S/C17H17N5OS/c1-22-11-13(10-20-22)12-6-15(8-16(7-12)24-18)21-17(23)9-14-4-2-3-5-19-14/h2-8,10-11H,9,18H2,1H3,(H,21,23) |
| InChIKey | MIIXBLKEPYQSIQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|