C18H15ClF2N4OS — CID 172630073
N-[3-aminosulfanyl-5-(1-methylpyrazol-4-yl)phenyl]-2-(2-chlorophenyl)-2,2-difluoroacetamide (PubChem CID 172630073) has the molecular formula C18H15ClF2N4OS and a molecular weight of 408.86 g/mol. Its IUPAC name is N-[3-aminosulfanyl-5-(1-methylpyrazol-4-yl)phenyl]-2-(2-chlorophenyl)-2,2-difluoroacetamide.
| Compound Name | N-[3-aminosulfanyl-5-(1-methylpyrazol-4-yl)phenyl]-2-(2-chlorophenyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 172630073 |
| Molecular Formula | C18H15ClF2N4OS |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | N-[3-aminosulfanyl-5-(1-methylpyrazol-4-yl)phenyl]-2-(2-chlorophenyl)-2,2-difluoroacetamide |
| SMILES | Cn1cc(-c2cc(NC(=O)C(F)(F)c3ccccc3Cl)cc(SN)c2)cn1 |
| InChI | InChI=1S/C18H15ClF2N4OS/c1-25-10-12(9-23-25)11-6-13(8-14(7-11)27-22)24-17(26)18(20,21)15-4-2-3-5-16(15)19/h2-10H,22H2,1H3,(H,24,26) |
| InChIKey | PDEUVRFAXZNGIZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|