C20H22ClN3O4S — CID 134588175
2-(2-chlorophenyl)-N-[4-(3-methylpyrrolidine-1-carbonyl)-3-sulfamoylphenyl]acetamide (PubChem CID 134588175) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[4-(3-methylpyrrolidine-1-carbonyl)-3-sulfamoylphenyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[4-(3-methylpyrrolidine-1-carbonyl)-3-sulfamoylphenyl]acetamide |
|---|---|
| PubChem CID | 134588175 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[4-(3-methylpyrrolidine-1-carbonyl)-3-sulfamoylphenyl]acetamide |
| SMILES | CC1CCN(C(=O)c2ccc(NC(=O)Cc3ccccc3Cl)cc2S(N)(=O)=O)C1 |
| InChI | InChI=1S/C20H22ClN3O4S/c1-13-8-9-24(12-13)20(26)16-7-6-15(11-18(16)29(22,27)28)23-19(25)10-14-4-2-3-5-17(14)21/h2-7,11,13H,8-10,12H2,1H3,(H,23,25)(H2,22,27,28) |
| InChIKey | VCZSCJSMHHLOGT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |