C20H20ClF3N4O4S — CID 167629529
N-[4-[1-amino-3-[2-(trifluoromethoxy)ethylimino]prop-1-en-2-yl]-3-sulfamoylphenyl]-2-(2-chlorophenyl)acetamide (PubChem CID 167629529) has the molecular formula C20H20ClF3N4O4S and a molecular weight of 504.92 g/mol. Its IUPAC name is N-[4-[1-amino-3-[2-(trifluoromethoxy)ethylimino]prop-1-en-2-yl]-3-sulfamoylphenyl]-2-(2-chlorophenyl)acetamide.
| Compound Name | N-[4-[1-amino-3-[2-(trifluoromethoxy)ethylimino]prop-1-en-2-yl]-3-sulfamoylphenyl]-2-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 167629529 |
| Molecular Formula | C20H20ClF3N4O4S |
| Molecular Weight | 504.92 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | N-[4-[1-amino-3-[2-(trifluoromethoxy)ethylimino]prop-1-en-2-yl]-3-sulfamoylphenyl]-2-(2-chlorophenyl)acetamide |
| SMILES | NC=C(/C=N/CCOC(F)(F)F)c1ccc(NC(=O)Cc2ccccc2Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C20H20ClF3N4O4S/c21-17-4-2-1-3-13(17)9-19(29)28-15-5-6-16(18(10-15)33(26,30)31)14(11-25)12-27-7-8-32-20(22,23)24/h1-6,10-12H,7-9,25H2,(H,28,29)(H2,26,30,31)/b14-11?,27-12+ |
| InChIKey | XPNJJPJFLWTSPH-BAFZNSEUSA-N |
| XLogP | 3.08 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.92 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|