C19H18ClF3N4O3S — CID 163625310
N-[4-(3-amino-4,4,4-trifluoro-1-methyliminobut-2-en-2-yl)-3-sulfamoylphenyl]-2-(2-chlorophenyl)acetamide (PubChem CID 163625310) has the molecular formula C19H18ClF3N4O3S and a molecular weight of 474.89 g/mol. Its IUPAC name is N-[4-(3-amino-4,4,4-trifluoro-1-methyliminobut-2-en-2-yl)-3-sulfamoylphenyl]-2-(2-chlorophenyl)acetamide.
| Compound Name | N-[4-(3-amino-4,4,4-trifluoro-1-methyliminobut-2-en-2-yl)-3-sulfamoylphenyl]-2-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 163625310 |
| Molecular Formula | C19H18ClF3N4O3S |
| Molecular Weight | 474.89 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | N-[4-(3-amino-4,4,4-trifluoro-1-methyliminobut-2-en-2-yl)-3-sulfamoylphenyl]-2-(2-chlorophenyl)acetamide |
| SMILES | C/N=C/C(=C(N)C(F)(F)F)c1ccc(NC(=O)Cc2ccccc2Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H18ClF3N4O3S/c1-26-10-14(18(24)19(21,22)23)13-7-6-12(9-16(13)31(25,29)30)27-17(28)8-11-4-2-3-5-15(11)20/h2-7,9-10H,8,24H2,1H3,(H,27,28)(H2,25,29,30)/b18-14?,26-10+ |
| InChIKey | UDRRWVGZYVZIQL-SGVWNBPVSA-N |
| XLogP | 3.10 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.89 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|