C18H16ClFN2O6 — CID 7887713
[2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl] 2-fluoro-4-methoxybenzoate (PubChem CID 7887713) has the molecular formula C18H16ClFN2O6 and a molecular weight of 410.79 g/mol. Its IUPAC name is [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl] 2-fluoro-4-methoxybenzoate.
| Compound Name | [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl] 2-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 7887713 |
| Molecular Formula | C18H16ClFN2O6 |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl] 2-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NNC(=O)COc2ccc(Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C18H16ClFN2O6/c1-26-13-6-7-14(15(20)8-13)18(25)28-10-17(24)22-21-16(23)9-27-12-4-2-11(19)3-5-12/h2-8H,9-10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | UIPGMUUOANLCAU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|