C10H14ClNO5S — CID 103491161
1-ethoxypropan-2-yl 4-chlorosulfonyl-1H-pyrrole-2-carboxylate (PubChem CID 103491161) has the molecular formula C10H14ClNO5S and a molecular weight of 295.74 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl 4-chlorosulfonyl-1H-pyrrole-2-carboxylate.
| Compound Name | 1-ethoxypropan-2-yl 4-chlorosulfonyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 103491161 |
| Molecular Formula | C10H14ClNO5S |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 1-ethoxypropan-2-yl 4-chlorosulfonyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOCC(C)OC(=O)c1cc(S(=O)(=O)Cl)c[nH]1 |
| InChI | InChI=1S/C10H14ClNO5S/c1-3-16-6-7(2)17-10(13)9-4-8(5-12-9)18(11,14)15/h4-5,7,12H,3,6H2,1-2H3 |
| InChIKey | RTUAVVQHNUDUFF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |