C23H28FN3O5S — CID 42964897
[2-(butan-2-ylamino)-2-oxoethyl] 3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoate (PubChem CID 42964897) has the molecular formula C23H28FN3O5S and a molecular weight of 477.56 g/mol. Its IUPAC name is [2-(butan-2-ylamino)-2-oxoethyl] 3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoate.
| Compound Name | [2-(butan-2-ylamino)-2-oxoethyl] 3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 42964897 |
| Molecular Formula | C23H28FN3O5S |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | [2-(butan-2-ylamino)-2-oxoethyl] 3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoate |
| SMILES | CCC(C)NC(=O)COC(=O)c1cccc(S(=O)(=O)N2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C23H28FN3O5S/c1-3-17(2)25-22(28)16-32-23(29)18-5-4-6-21(15-18)33(30,31)27-13-11-26(12-14-27)20-9-7-19(24)8-10-20/h4-10,15,17H,3,11-14,16H2,1-2H3,(H,25,28) |
| InChIKey | UESQTUDJFFPSTD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |