C16H20N2O4S — CID 7829715
[(1S)-1-cyanoethyl] 3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate (PubChem CID 7829715) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] 3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate.
| Compound Name | [(1S)-1-cyanoethyl] 3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 7829715 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [(1S)-1-cyanoethyl] 3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate |
| SMILES | C[C@@H]1CCCCN1S(=O)(=O)c1cccc(C(=O)O[C@@H](C)C#N)c1 |
| InChI | InChI=1S/C16H20N2O4S/c1-12-6-3-4-9-18(12)23(20,21)15-8-5-7-14(10-15)16(19)22-13(2)11-17/h5,7-8,10,12-13H,3-4,6,9H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | SQYVINKSAIGVRG-OLZOCXBDSA-N |
| XLogP | 2.32 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |