C14H16N2O5S — CID 2508494
[(1R)-1-cyanoethyl] 3-morpholin-4-ylsulfonylbenzoate (PubChem CID 2508494) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [(1R)-1-cyanoethyl] 3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2508494 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | [(1R)-1-cyanoethyl] 3-morpholin-4-ylsulfonylbenzoate |
| SMILES | C[C@H](C#N)OC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C14H16N2O5S/c1-11(10-15)21-14(17)12-3-2-4-13(9-12)22(18,19)16-5-7-20-8-6-16/h2-4,9,11H,5-8H2,1H3/t11-/m1/s1 |
| InChIKey | CMNKPRNGRVBSHK-LLVKDONJSA-N |
| XLogP | 0.78 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |