C22H22N4O4 — CID 56544955
3,5-diacetamido-N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]benzamide (PubChem CID 56544955) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 3,5-diacetamido-N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]benzamide.
| Compound Name | 3,5-diacetamido-N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 56544955 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3,5-diacetamido-N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]benzamide |
| SMILES | CCc1ccc(-c2cc(NC(=O)c3cc(NC(C)=O)cc(NC(C)=O)c3)on2)cc1 |
| InChI | InChI=1S/C22H22N4O4/c1-4-15-5-7-16(8-6-15)20-12-21(30-26-20)25-22(29)17-9-18(23-13(2)27)11-19(10-17)24-14(3)28/h5-12H,4H2,1-3H3,(H,23,27)(H,24,28)(H,25,29) |
| InChIKey | SGUZZDCIOAPOBS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |