C18H14F2N2O2 — CID 56569806
N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-2,5-difluorobenzamide (PubChem CID 56569806) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-2,5-difluorobenzamide.
| Compound Name | N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 56569806 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-2,5-difluorobenzamide |
| SMILES | CCc1ccc(-c2cc(NC(=O)c3cc(F)ccc3F)on2)cc1 |
| InChI | InChI=1S/C18H14F2N2O2/c1-2-11-3-5-12(6-4-11)16-10-17(24-22-16)21-18(23)14-9-13(19)7-8-15(14)20/h3-10H,2H2,1H3,(H,21,23) |
| InChIKey | DTLPTZUTURRBOA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |