C19H15N3O2 — CID 56529985
4-cyano-N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]benzamide (PubChem CID 56529985) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-cyano-N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]benzamide.
| Compound Name | 4-cyano-N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 56529985 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 4-cyano-N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]benzamide |
| SMILES | CCc1ccc(-c2cc(NC(=O)c3ccc(C#N)cc3)on2)cc1 |
| InChI | InChI=1S/C19H15N3O2/c1-2-13-3-7-15(8-4-13)17-11-18(24-22-17)21-19(23)16-9-5-14(12-20)6-10-16/h3-11H,2H2,1H3,(H,21,23) |
| InChIKey | ADYKSALSMPODRY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |