C24H16N2O5 — CID 7808243
(3-oxobenzo[f]chromen-1-yl)methyl 4-[(2-cyanoacetyl)amino]benzoate (PubChem CID 7808243) has the molecular formula C24H16N2O5 and a molecular weight of 412.40 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 4-[(2-cyanoacetyl)amino]benzoate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 4-[(2-cyanoacetyl)amino]benzoate |
|---|---|
| PubChem CID | 7808243 |
| Molecular Formula | C24H16N2O5 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 4-[(2-cyanoacetyl)amino]benzoate |
| SMILES | N#CCC(=O)Nc1ccc(C(=O)OCc2cc(=O)oc3ccc4ccccc4c23)cc1 |
| InChI | InChI=1S/C24H16N2O5/c25-12-11-21(27)26-18-8-5-16(6-9-18)24(29)30-14-17-13-22(28)31-20-10-7-15-3-1-2-4-19(15)23(17)20/h1-10,13H,11,14H2,(H,26,27) |
| InChIKey | URIJTDJDMKRJTC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|