C23H28F3N3O3 — CID 91053637
N-butyl-4-[2-[[2-(methylamino)-2-[4-(trifluoromethoxy)phenyl]acetyl]amino]ethyl]benzamide (PubChem CID 91053637) has the molecular formula C23H28F3N3O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is N-butyl-4-[2-[[2-(methylamino)-2-[4-(trifluoromethoxy)phenyl]acetyl]amino]ethyl]benzamide.
| Compound Name | N-butyl-4-[2-[[2-(methylamino)-2-[4-(trifluoromethoxy)phenyl]acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 91053637 |
| Molecular Formula | C23H28F3N3O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N-butyl-4-[2-[[2-(methylamino)-2-[4-(trifluoromethoxy)phenyl]acetyl]amino]ethyl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(CCNC(=O)C(NC)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H28F3N3O3/c1-3-4-14-28-21(30)18-7-5-16(6-8-18)13-15-29-22(31)20(27-2)17-9-11-19(12-10-17)32-23(24,25)26/h5-12,20,27H,3-4,13-15H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | RWFLGICIBOOTBY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|