C17H19ClFNO4S — CID 110309069
N-[2-(4-chlorophenyl)-2-hydroxypropyl]-2-(4-fluorophenoxy)ethanesulfonamide (PubChem CID 110309069) has the molecular formula C17H19ClFNO4S and a molecular weight of 387.86 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-hydroxypropyl]-2-(4-fluorophenoxy)ethanesulfonamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-hydroxypropyl]-2-(4-fluorophenoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 110309069 |
| Molecular Formula | C17H19ClFNO4S |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-hydroxypropyl]-2-(4-fluorophenoxy)ethanesulfonamide |
| SMILES | CC(O)(CNS(=O)(=O)CCOc1ccc(F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClFNO4S/c1-17(21,13-2-4-14(18)5-3-13)12-20-25(22,23)11-10-24-16-8-6-15(19)7-9-16/h2-9,20-21H,10-12H2,1H3 |
| InChIKey | XYYFCIOLXZWQJF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |