C25H28ClNO4 — CID 10433437
7-(4-chlorophenoxy)-2,2-dimethyl-N-(7-methyl-4-oxochromen-8-yl)heptanamide (PubChem CID 10433437) has the molecular formula C25H28ClNO4 and a molecular weight of 441.96 g/mol. Its IUPAC name is 7-(4-chlorophenoxy)-2,2-dimethyl-N-(7-methyl-4-oxochromen-8-yl)heptanamide.
| Compound Name | 7-(4-chlorophenoxy)-2,2-dimethyl-N-(7-methyl-4-oxochromen-8-yl)heptanamide |
|---|---|
| PubChem CID | 10433437 |
| Molecular Formula | C25H28ClNO4 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 7-(4-chlorophenoxy)-2,2-dimethyl-N-(7-methyl-4-oxochromen-8-yl)heptanamide |
| SMILES | Cc1ccc2c(=O)ccoc2c1NC(=O)C(C)(C)CCCCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H28ClNO4/c1-17-7-12-20-21(28)13-16-31-23(20)22(17)27-24(29)25(2,3)14-5-4-6-15-30-19-10-8-18(26)9-11-19/h7-13,16H,4-6,14-15H2,1-3H3,(H,27,29) |
| InChIKey | IEOHTSIMBAEKFQ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|