C35H50ClNO5 — CID 10393792
8-(4-chlorophenoxy)-N-(7-decoxy-4-oxo-2,3-dihydrochromen-8-yl)-2,2-dimethyloctanamide (PubChem CID 10393792) has the molecular formula C35H50ClNO5 and a molecular weight of 600.24 g/mol. Its IUPAC name is 8-(4-chlorophenoxy)-N-(7-decoxy-4-oxo-2,3-dihydrochromen-8-yl)-2,2-dimethyloctanamide.
| Compound Name | 8-(4-chlorophenoxy)-N-(7-decoxy-4-oxo-2,3-dihydrochromen-8-yl)-2,2-dimethyloctanamide |
|---|---|
| PubChem CID | 10393792 |
| Molecular Formula | C35H50ClNO5 |
| Molecular Weight | 600.24 g/mol |
| Exact Mass | 599.34 |
| IUPAC Name | 8-(4-chlorophenoxy)-N-(7-decoxy-4-oxo-2,3-dihydrochromen-8-yl)-2,2-dimethyloctanamide |
| SMILES | CCCCCCCCCCOc1ccc2c(c1NC(=O)C(C)(C)CCCCCCOc1ccc(Cl)cc1)OCCC2=O |
| InChI | InChI=1S/C35H50ClNO5/c1-4-5-6-7-8-9-11-15-25-41-31-21-20-29-30(38)22-26-42-33(29)32(31)37-34(39)35(2,3)23-13-10-12-14-24-40-28-18-16-27(36)17-19-28/h16-21H,4-15,22-26H2,1-3H3,(H,37,39) |
| InChIKey | QEDGZWHZRKCUFC-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.24 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|