C26H32N2O7 — CID 86749976
N-(7-methoxy-4-oxo-2,3-dihydrochromen-8-yl)-2,2-dimethyl-8-(4-nitrophenoxy)octanamide (PubChem CID 86749976) has the molecular formula C26H32N2O7 and a molecular weight of 484.55 g/mol. Its IUPAC name is N-(7-methoxy-4-oxo-2,3-dihydrochromen-8-yl)-2,2-dimethyl-8-(4-nitrophenoxy)octanamide.
| Compound Name | N-(7-methoxy-4-oxo-2,3-dihydrochromen-8-yl)-2,2-dimethyl-8-(4-nitrophenoxy)octanamide |
|---|---|
| PubChem CID | 86749976 |
| Molecular Formula | C26H32N2O7 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | N-(7-methoxy-4-oxo-2,3-dihydrochromen-8-yl)-2,2-dimethyl-8-(4-nitrophenoxy)octanamide |
| SMILES | COc1ccc2c(c1NC(=O)C(C)(C)CCCCCCOc1ccc([N+](=O)[O-])cc1)OCCC2=O |
| InChI | InChI=1S/C26H32N2O7/c1-26(2,15-6-4-5-7-16-34-19-10-8-18(9-11-19)28(31)32)25(30)27-23-22(33-3)13-12-20-21(29)14-17-35-24(20)23/h8-13H,4-7,14-17H2,1-3H3,(H,27,30) |
| InChIKey | JGPJUDYLUFIOSN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|