C26H32O6 — CID 19921949
3-[3-[5-[(4-oxo-8-propyl-2,3-dihydrochromen-7-yl)oxy]pentoxy]phenyl]propanoic acid (PubChem CID 19921949) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is 3-[3-[5-[(4-oxo-8-propyl-2,3-dihydrochromen-7-yl)oxy]pentoxy]phenyl]propanoic acid.
| Compound Name | 3-[3-[5-[(4-oxo-8-propyl-2,3-dihydrochromen-7-yl)oxy]pentoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 19921949 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 3-[3-[5-[(4-oxo-8-propyl-2,3-dihydrochromen-7-yl)oxy]pentoxy]phenyl]propanoic acid |
| SMILES | CCCc1c(OCCCCCOc2cccc(CCC(=O)O)c2)ccc2c1OCCC2=O |
| InChI | InChI=1S/C26H32O6/c1-2-7-22-24(12-11-21-23(27)14-17-32-26(21)22)31-16-5-3-4-15-30-20-9-6-8-19(18-20)10-13-25(28)29/h6,8-9,11-12,18H,2-5,7,10,13-17H2,1H3,(H,28,29) |
| InChIKey | JZOQYKHTZRWOBS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|