C32H36O9 — CID 19922128
3-[7-(carboxymethoxy)-2-[5-[(4-oxo-8-propyl-2,3-dihydrochromen-7-yl)oxy]pentoxy]naphthalen-1-yl]propanoic acid (PubChem CID 19922128) has the molecular formula C32H36O9 and a molecular weight of 564.63 g/mol. Its IUPAC name is 3-[7-(carboxymethoxy)-2-[5-[(4-oxo-8-propyl-2,3-dihydrochromen-7-yl)oxy]pentoxy]naphthalen-1-yl]propanoic acid.
| Compound Name | 3-[7-(carboxymethoxy)-2-[5-[(4-oxo-8-propyl-2,3-dihydrochromen-7-yl)oxy]pentoxy]naphthalen-1-yl]propanoic acid |
|---|---|
| PubChem CID | 19922128 |
| Molecular Formula | C32H36O9 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 3-[7-(carboxymethoxy)-2-[5-[(4-oxo-8-propyl-2,3-dihydrochromen-7-yl)oxy]pentoxy]naphthalen-1-yl]propanoic acid |
| SMILES | CCCc1c(OCCCCCOc2ccc3ccc(OCC(=O)O)cc3c2CCC(=O)O)ccc2c1OCCC2=O |
| InChI | InChI=1S/C32H36O9/c1-2-6-25-29(13-10-24-27(33)15-18-40-32(24)25)39-17-5-3-4-16-38-28-12-8-21-7-9-22(41-20-31(36)37)19-26(21)23(28)11-14-30(34)35/h7-10,12-13,19H,2-6,11,14-18,20H2,1H3,(H,34,35)(H,36,37) |
| InChIKey | YYYBDTYPJSSRKF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|