C28H42O7 — CID 15157481
3-[2-(2-carboxyethyl)-7-decoxy-4-oxo-8-propyl-3H-chromen-2-yl]propanoic acid (PubChem CID 15157481) has the molecular formula C28H42O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is 3-[2-(2-carboxyethyl)-7-decoxy-4-oxo-8-propyl-3H-chromen-2-yl]propanoic acid.
| Compound Name | 3-[2-(2-carboxyethyl)-7-decoxy-4-oxo-8-propyl-3H-chromen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 15157481 |
| Molecular Formula | C28H42O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 3-[2-(2-carboxyethyl)-7-decoxy-4-oxo-8-propyl-3H-chromen-2-yl]propanoic acid |
| SMILES | CCCCCCCCCCOc1ccc2c(c1CCC)OC(CCC(=O)O)(CCC(=O)O)CC2=O |
| InChI | InChI=1S/C28H42O7/c1-3-5-6-7-8-9-10-11-19-34-24-14-13-21-23(29)20-28(17-15-25(30)31,18-16-26(32)33)35-27(21)22(24)12-4-2/h13-14H,3-12,15-20H2,1-2H3,(H,30,31)(H,32,33) |
| InChIKey | XREZLGJAYCEAJP-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|