C20H27IO5 — CID 57034165
methyl 2-[[2-(4-iodobutyl)-2-methyl-4-oxo-8-propyl-3H-chromen-7-yl]oxy]acetate (PubChem CID 57034165) has the molecular formula C20H27IO5 and a molecular weight of 474.34 g/mol. Its IUPAC name is methyl 2-[[2-(4-iodobutyl)-2-methyl-4-oxo-8-propyl-3H-chromen-7-yl]oxy]acetate.
| Compound Name | methyl 2-[[2-(4-iodobutyl)-2-methyl-4-oxo-8-propyl-3H-chromen-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 57034165 |
| Molecular Formula | C20H27IO5 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | methyl 2-[[2-(4-iodobutyl)-2-methyl-4-oxo-8-propyl-3H-chromen-7-yl]oxy]acetate |
| SMILES | CCCc1c(OCC(=O)OC)ccc2c1OC(C)(CCCCI)CC2=O |
| InChI | InChI=1S/C20H27IO5/c1-4-7-15-17(25-13-18(23)24-3)9-8-14-16(22)12-20(2,26-19(14)15)10-5-6-11-21/h8-9H,4-7,10-13H2,1-3H3 |
| InChIKey | YXHUHMODNQWLSU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|