C14H16O6 — CID 75357275
2-(7,8-dimethoxy-2-methyl-4-oxo-3H-chromen-2-yl)acetic acid (PubChem CID 75357275) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-(7,8-dimethoxy-2-methyl-4-oxo-3H-chromen-2-yl)acetic acid.
| Compound Name | 2-(7,8-dimethoxy-2-methyl-4-oxo-3H-chromen-2-yl)acetic acid |
|---|---|
| PubChem CID | 75357275 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-(7,8-dimethoxy-2-methyl-4-oxo-3H-chromen-2-yl)acetic acid |
| SMILES | COc1ccc2c(c1OC)OC(C)(CC(=O)O)CC2=O |
| InChI | InChI=1S/C14H16O6/c1-14(7-11(16)17)6-9(15)8-4-5-10(18-2)13(19-3)12(8)20-14/h4-5H,6-7H2,1-3H3,(H,16,17) |
| InChIKey | BOVINXINRPEAML-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |