C20H28O6 — CID 88596974
ethyl 4-[2-(4-hydroxybutyl)-2-methyl-4-oxo-3H-chromen-7-yl]butaneperoxoate (PubChem CID 88596974) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is ethyl 4-[2-(4-hydroxybutyl)-2-methyl-4-oxo-3H-chromen-7-yl]butaneperoxoate.
| Compound Name | ethyl 4-[2-(4-hydroxybutyl)-2-methyl-4-oxo-3H-chromen-7-yl]butaneperoxoate |
|---|---|
| PubChem CID | 88596974 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | ethyl 4-[2-(4-hydroxybutyl)-2-methyl-4-oxo-3H-chromen-7-yl]butaneperoxoate |
| SMILES | CCOOC(=O)CCCc1ccc2c(c1)OC(C)(CCCCO)CC2=O |
| InChI | InChI=1S/C20H28O6/c1-3-24-26-19(23)8-6-7-15-9-10-16-17(22)14-20(2,11-4-5-12-21)25-18(16)13-15/h9-10,13,21H,3-8,11-12,14H2,1-2H3 |
| InChIKey | NCNNDBMUUZBUMA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|