C20H14ClNO3 — CID 69018063
6-[(5-chloro-2-pyridinyl)oxy]-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 69018063) has the molecular formula C20H14ClNO3 and a molecular weight of 351.79 g/mol. Its IUPAC name is 6-[(5-chloro-2-pyridinyl)oxy]-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | 6-[(5-chloro-2-pyridinyl)oxy]-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 69018063 |
| Molecular Formula | C20H14ClNO3 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 6-[(5-chloro-2-pyridinyl)oxy]-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2ccccc2)Oc2ccc(Oc3ccc(Cl)cn3)cc21 |
| InChI | InChI=1S/C20H14ClNO3/c21-14-6-9-20(22-12-14)24-15-7-8-18-16(10-15)17(23)11-19(25-18)13-4-2-1-3-5-13/h1-10,12,19H,11H2 |
| InChIKey | KQPHZSGMLYDJPM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |