C35H45IN2O5 — CID 142204894
2-(dimethylamino)-N-[8-[(4-oxo-2-phenyl-2,3-dihydrochromen-6-yl)oxy]octyl]-3-phenylpropanamide;methyl hypoiodite (PubChem CID 142204894) has the molecular formula C35H45IN2O5 and a molecular weight of 700.66 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[8-[(4-oxo-2-phenyl-2,3-dihydrochromen-6-yl)oxy]octyl]-3-phenylpropanamide;methyl hypoiodite.
| Compound Name | 2-(dimethylamino)-N-[8-[(4-oxo-2-phenyl-2,3-dihydrochromen-6-yl)oxy]octyl]-3-phenylpropanamide;methyl hypoiodite |
|---|---|
| PubChem CID | 142204894 |
| Molecular Formula | C35H45IN2O5 |
| Molecular Weight | 700.66 g/mol |
| Exact Mass | 700.24 |
| IUPAC Name | 2-(dimethylamino)-N-[8-[(4-oxo-2-phenyl-2,3-dihydrochromen-6-yl)oxy]octyl]-3-phenylpropanamide;methyl hypoiodite |
| SMILES | CN(C)C(Cc1ccccc1)C(=O)NCCCCCCCCOc1ccc2c(c1)C(=O)CC(c1ccccc1)O2.COI |
| InChI | InChI=1S/C34H42N2O4.CH3IO/c1-36(2)30(23-26-15-9-7-10-16-26)34(38)35-21-13-5-3-4-6-14-22-39-28-19-20-32-29(24-28)31(37)25-33(40-32)27-17-11-8-12-18-27;1-3-2/h7-12,15-20,24,30,33H,3-6,13-14,21-23,25H2,1-2H3,(H,35,38);1H3 |
| InChIKey | RSISIEHIISRMDL-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.66 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|