C31H38N2O4 — CID 100583526
N-benzyl-N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methoxyphenoxy)butanamide (PubChem CID 100583526) has the molecular formula C31H38N2O4 and a molecular weight of 502.66 g/mol. Its IUPAC name is N-benzyl-N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methoxyphenoxy)butanamide.
| Compound Name | N-benzyl-N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 100583526 |
| Molecular Formula | C31H38N2O4 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | N-benzyl-N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methoxyphenoxy)butanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1)C(=O)CCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C31H38N2O4/c1-3-4-21-32-31(35)29(23-25-12-7-5-8-13-25)33(24-26-14-9-6-10-15-26)30(34)16-11-22-37-28-19-17-27(36-2)18-20-28/h5-10,12-15,17-20,29H,3-4,11,16,21-24H2,1-2H3,(H,32,35)/t29-/m1/s1 |
| InChIKey | RSBJSDFKYMJNNX-GDLZYMKVSA-N |
| XLogP | 5.41 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|