C30H35ClN2O4 — CID 132622485
N-[(2-chlorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[1-oxo-3-phenyl-1-(propylamino)propan-2-yl]butanamide (PubChem CID 132622485) has the molecular formula C30H35ClN2O4 and a molecular weight of 523.07 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[1-oxo-3-phenyl-1-(propylamino)propan-2-yl]butanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[1-oxo-3-phenyl-1-(propylamino)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 132622485 |
| Molecular Formula | C30H35ClN2O4 |
| Molecular Weight | 523.07 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[1-oxo-3-phenyl-1-(propylamino)propan-2-yl]butanamide |
| SMILES | CCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)CCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C30H35ClN2O4/c1-3-19-32-30(35)28(21-23-10-5-4-6-11-23)33(22-24-12-7-8-13-27(24)31)29(34)14-9-20-37-26-17-15-25(36-2)16-18-26/h4-8,10-13,15-18,28H,3,9,14,19-22H2,1-2H3,(H,32,35) |
| InChIKey | OCYZQOPVMAQHAG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.07 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|