C20H28N2O4 — CID 174626271
2-amino-3-(4-hydroxyphenyl)propanoic acid;benzene;pentanamide (PubChem CID 174626271) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxyphenyl)propanoic acid;benzene;pentanamide.
| Compound Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;benzene;pentanamide |
|---|---|
| PubChem CID | 174626271 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;benzene;pentanamide |
| SMILES | CCCCC(N)=O.NC(Cc1ccc(O)cc1)C(=O)O.c1ccccc1 |
| InChI | InChI=1S/C9H11NO3.C6H6.C5H11NO/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;1-2-4-6-5-3-1;1-2-3-4-5(6)7/h1-4,8,11H,5,10H2,(H,12,13);1-6H;2-4H2,1H3,(H2,6,7) |
| InChIKey | DHMJLNZODVPPKX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |