C10H25N2O3S+ — CID 87095339
2-amino-4-methylsulfanylbutanoic acid;2-hydroxyethyl(trimethyl)azanium (PubChem CID 87095339) has the molecular formula C10H25N2O3S+ and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanoic acid;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 2-amino-4-methylsulfanylbutanoic acid;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 87095339 |
| Molecular Formula | C10H25N2O3S+ |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CSCCC(N)C(=O)O.C[N+](C)(C)CCO |
| InChI | InChI=1S/C5H11NO2S.C5H14NO/c1-9-3-2-4(6)5(7)8;1-6(2,3)4-5-7/h4H,2-3,6H2,1H3,(H,7,8);7H,4-5H2,1-3H3/q;+1 |
| InChIKey | OGRRRARHNPXFJF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|