C8H18N2O5S — CID 22104052
2-amino-3-hydroxypropanoic acid;2-amino-4-methylsulfanylbutanoic acid (PubChem CID 22104052) has the molecular formula C8H18N2O5S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-amino-3-hydroxypropanoic acid;2-amino-4-methylsulfanylbutanoic acid.
| Compound Name | 2-amino-3-hydroxypropanoic acid;2-amino-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 22104052 |
| Molecular Formula | C8H18N2O5S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-amino-3-hydroxypropanoic acid;2-amino-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(N)C(=O)O.NC(CO)C(=O)O |
| InChI | InChI=1S/C5H11NO2S.C3H7NO3/c1-9-3-2-4(6)5(7)8;4-2(1-5)3(6)7/h4H,2-3,6H2,1H3,(H,7,8);2,5H,1,4H2,(H,6,7) |
| InChIKey | XMAGGKXFUYTRAI-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |