About dioxouranium(2+);bis(4-oxopentanoate)
dioxouranium(2+);bis(4-oxopentanoate) (PubChem CID 122625269) has the molecular formula C10H14O8U
and a molecular weight of 500.24 g/mol. Its IUPAC name is dioxouranium(2+);bis(4-oxopentanoate).
Molecular Properties
| Compound Name | dioxouranium(2+);bis(4-oxopentanoate) |
| PubChem CID | 122625269 |
| Molecular Formula | C10H14O8U |
| Molecular Weight | 500.24 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | dioxouranium(2+);bis(4-oxopentanoate) |
| SMILES | CC(=O)CCC(=O)[O-].CC(=O)CCC(=O)[O-].O=[U+2]=O |
| InChI | InChI=1S/2C5H8O3.2O.U/c2*1-4(6)2-3-5(7)8;;;/h2*2-3H2,1H3,(H,7,8);;;/q;;;;+2/p-2 |
| InChIKey | IVCODJPLTSGCPH-UHFFFAOYSA-L |
| XLogP | -2.03 |
| TPSA | 148.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.24 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze dioxouranium(2+);bis(4-oxopentanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxouranium(2+);bis(4-oxopentanoate)?
The IUPAC name of dioxouranium(2+);bis(4-oxopentanoate) (CID 122625269) is dioxouranium(2+);bis(4-oxopentanoate).
What is the SMILES notation for dioxouranium(2+);bis(4-oxopentanoate)?
The canonical SMILES for dioxouranium(2+);bis(4-oxopentanoate) is CC(=O)CCC(=O)[O-].CC(=O)CCC(=O)[O-].O=[U+2]=O.
What is the InChIKey of dioxouranium(2+);bis(4-oxopentanoate)?
The InChIKey is IVCODJPLTSGCPH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H8O3.2O.U/c2*1-4(6)2-3-5(7)8;;;/h2*2-3H2,1H3,(H,7,8);;;/q;;;;+2/p-2.
What are the key properties of dioxouranium(2+);bis(4-oxopentanoate)?
dioxouranium(2+);bis(4-oxopentanoate) has a molecular weight of 500.24 g/mol, XLogP of -2.03, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dioxouranium(2+);bis(4-oxopentanoate) is sourced from PubChem (CID 122625269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).