About sodium;4-oxopentanoate;4-oxopentanoic acid
sodium;4-oxopentanoate;4-oxopentanoic acid (PubChem CID 159759335) has the molecular formula C10H15NaO6
and a molecular weight of 254.21 g/mol. Its IUPAC name is sodium;4-oxopentanoate;4-oxopentanoic acid.
Molecular Properties
| Compound Name | sodium;4-oxopentanoate;4-oxopentanoic acid |
| PubChem CID | 159759335 |
| Molecular Formula | C10H15NaO6 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | sodium;4-oxopentanoate;4-oxopentanoic acid |
| SMILES | CC(=O)CCC(=O)O.CC(=O)CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/2C5H8O3.Na/c2*1-4(6)2-3-5(7)8;/h2*2-3H2,1H3,(H,7,8);/q;;+1/p-1 |
| InChIKey | NERFSHOHJSQOMN-UHFFFAOYSA-M |
| XLogP | -3.45 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium;4-oxopentanoate;4-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-oxopentanoate;4-oxopentanoic acid?
The IUPAC name of sodium;4-oxopentanoate;4-oxopentanoic acid (CID 159759335) is sodium;4-oxopentanoate;4-oxopentanoic acid.
What is the SMILES notation for sodium;4-oxopentanoate;4-oxopentanoic acid?
The canonical SMILES for sodium;4-oxopentanoate;4-oxopentanoic acid is CC(=O)CCC(=O)O.CC(=O)CCC(=O)[O-].[Na+].
What is the InChIKey of sodium;4-oxopentanoate;4-oxopentanoic acid?
The InChIKey is NERFSHOHJSQOMN-UHFFFAOYSA-M. The full InChI is InChI=1S/2C5H8O3.Na/c2*1-4(6)2-3-5(7)8;/h2*2-3H2,1H3,(H,7,8);/q;;+1/p-1.
What are the key properties of sodium;4-oxopentanoate;4-oxopentanoic acid?
sodium;4-oxopentanoate;4-oxopentanoic acid has a molecular weight of 254.21 g/mol, XLogP of -3.45, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-oxopentanoate;4-oxopentanoic acid is sourced from PubChem (CID 159759335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).