About sodium;4-hydroxy-4-oxobutanoate;trichloroalumane
sodium;4-hydroxy-4-oxobutanoate;trichloroalumane (PubChem CID 175195215) has the molecular formula C4H5AlCl3NaO4
and a molecular weight of 273.41 g/mol. Its IUPAC name is sodium;4-hydroxy-4-oxobutanoate;trichloroalumane.
Molecular Properties
| Compound Name | sodium;4-hydroxy-4-oxobutanoate;trichloroalumane |
| PubChem CID | 175195215 |
| Molecular Formula | C4H5AlCl3NaO4 |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 271.90 |
| IUPAC Name | sodium;4-hydroxy-4-oxobutanoate;trichloroalumane |
| SMILES | Cl[Al](Cl)Cl.O=C([O-])CCC(=O)O.[Na+] |
| InChI | InChI=1S/C4H6O4.Al.3ClH.Na/c5-3(6)1-2-4(7)8;;;;;/h1-2H2,(H,5,6)(H,7,8);;3*1H;/q;+3;;;;+1/p-4 |
| InChIKey | CTWCYHRJUAGNKK-UHFFFAOYSA-J |
| XLogP | -2.71 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;4-hydroxy-4-oxobutanoate;trichloroalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-hydroxy-4-oxobutanoate;trichloroalumane?
The IUPAC name of sodium;4-hydroxy-4-oxobutanoate;trichloroalumane (CID 175195215) is sodium;4-hydroxy-4-oxobutanoate;trichloroalumane.
What is the SMILES notation for sodium;4-hydroxy-4-oxobutanoate;trichloroalumane?
The canonical SMILES for sodium;4-hydroxy-4-oxobutanoate;trichloroalumane is Cl[Al](Cl)Cl.O=C([O-])CCC(=O)O.[Na+].
What is the InChIKey of sodium;4-hydroxy-4-oxobutanoate;trichloroalumane?
The InChIKey is CTWCYHRJUAGNKK-UHFFFAOYSA-J. The full InChI is InChI=1S/C4H6O4.Al.3ClH.Na/c5-3(6)1-2-4(7)8;;;;;/h1-2H2,(H,5,6)(H,7,8);;3*1H;/q;+3;;;;+1/p-4.
What are the key properties of sodium;4-hydroxy-4-oxobutanoate;trichloroalumane?
sodium;4-hydroxy-4-oxobutanoate;trichloroalumane has a molecular weight of 273.41 g/mol, XLogP of -2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-hydroxy-4-oxobutanoate;trichloroalumane is sourced from PubChem (CID 175195215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).