About butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium
butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium (PubChem CID 139059168) has the molecular formula C14H28N2O8
and a molecular weight of 352.38 g/mol. Its IUPAC name is butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium.
Molecular Properties
| Compound Name | butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium |
| PubChem CID | 139059168 |
| Molecular Formula | C14H28N2O8 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium |
| SMILES | C[NH+](C)CC[NH+](C)C.O=C(O)CCC(=O)O.O=C([O-])CCC(=O)[O-] |
| InChI | InChI=1S/C6H16N2.2C4H6O4/c1-7(2)5-6-8(3)4;2*5-3(6)1-2-4(7)8/h5-6H2,1-4H3;2*1-2H2,(H,5,6)(H,7,8) |
| InChIKey | HLGTZTACCHASCV-UHFFFAOYSA-N |
| XLogP | -5.52 |
| TPSA | 163.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | -5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium?
The IUPAC name of butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium (CID 139059168) is butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium.
What is the SMILES notation for butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium?
The canonical SMILES for butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium is C[NH+](C)CC[NH+](C)C.O=C(O)CCC(=O)O.O=C([O-])CCC(=O)[O-].
What is the InChIKey of butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium?
The InChIKey is HLGTZTACCHASCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2.2C4H6O4/c1-7(2)5-6-8(3)4;2*5-3(6)1-2-4(7)8/h5-6H2,1-4H3;2*1-2H2,(H,5,6)(H,7,8).
What are the key properties of butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium?
butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium has a molecular weight of 352.38 g/mol, XLogP of -5.52, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioate;butanedioic acid;2-(dimethylazaniumyl)ethyl-dimethylazanium is sourced from PubChem (CID 139059168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).