About dipotassium;4-oxo-4-sulfidobutanoate
dipotassium;4-oxo-4-sulfidobutanoate (PubChem CID 87135702) has the molecular formula C4H4K2O3S
and a molecular weight of 210.34 g/mol. Its IUPAC name is dipotassium;4-oxo-4-sulfidobutanoate.
Molecular Properties
| Compound Name | dipotassium;4-oxo-4-sulfidobutanoate |
| PubChem CID | 87135702 |
| Molecular Formula | C4H4K2O3S |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 209.92 |
| IUPAC Name | dipotassium;4-oxo-4-sulfidobutanoate |
| SMILES | O=C([O-])CCC(=O)[S-].[K+].[K+] |
| InChI | InChI=1S/C4H6O3S.2K/c5-3(6)1-2-4(7)8;;/h1-2H2,(H,5,6)(H,7,8);;/q;2*+1/p-2 |
| InChIKey | MWSSRMDUWNCABS-UHFFFAOYSA-L |
| XLogP | -7.40 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | -7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;4-oxo-4-sulfidobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;4-oxo-4-sulfidobutanoate?
The IUPAC name of dipotassium;4-oxo-4-sulfidobutanoate (CID 87135702) is dipotassium;4-oxo-4-sulfidobutanoate.
What is the SMILES notation for dipotassium;4-oxo-4-sulfidobutanoate?
The canonical SMILES for dipotassium;4-oxo-4-sulfidobutanoate is O=C([O-])CCC(=O)[S-].[K+].[K+].
What is the InChIKey of dipotassium;4-oxo-4-sulfidobutanoate?
The InChIKey is MWSSRMDUWNCABS-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H6O3S.2K/c5-3(6)1-2-4(7)8;;/h1-2H2,(H,5,6)(H,7,8);;/q;2*+1/p-2.
What are the key properties of dipotassium;4-oxo-4-sulfidobutanoate?
dipotassium;4-oxo-4-sulfidobutanoate has a molecular weight of 210.34 g/mol, XLogP of -7.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;4-oxo-4-sulfidobutanoate is sourced from PubChem (CID 87135702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).