About potassium 4-chloropentanoate
potassium 4-chloropentanoate (PubChem CID 162525089) has the molecular formula C5H8ClKO2
and a molecular weight of 174.67 g/mol. Its IUPAC name is potassium 4-chloropentanoate.
Molecular Properties
| Compound Name | potassium 4-chloropentanoate |
| PubChem CID | 162525089 |
| Molecular Formula | C5H8ClKO2 |
| Molecular Weight | 174.67 g/mol |
| Exact Mass | 173.98 |
| IUPAC Name | potassium 4-chloropentanoate |
| SMILES | CC(Cl)CCC(=O)[O-].[K+] |
| InChI | InChI=1S/C5H9ClO2.K/c1-4(6)2-3-5(7)8;/h4H,2-3H2,1H3,(H,7,8);/q;+1/p-1 |
| InChIKey | AGUANCDOYFNHIP-UHFFFAOYSA-M |
| XLogP | -2.85 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.67 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze potassium 4-chloropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 4-chloropentanoate?
The IUPAC name of potassium 4-chloropentanoate (CID 162525089) is potassium 4-chloropentanoate.
What is the SMILES notation for potassium 4-chloropentanoate?
The canonical SMILES for potassium 4-chloropentanoate is CC(Cl)CCC(=O)[O-].[K+].
What is the InChIKey of potassium 4-chloropentanoate?
The InChIKey is AGUANCDOYFNHIP-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H9ClO2.K/c1-4(6)2-3-5(7)8;/h4H,2-3H2,1H3,(H,7,8);/q;+1/p-1.
What are the key properties of potassium 4-chloropentanoate?
potassium 4-chloropentanoate has a molecular weight of 174.67 g/mol, XLogP of -2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 4-chloropentanoate is sourced from PubChem (CID 162525089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).