About potassium (E)-4-chlorooct-5-enoate
potassium (E)-4-chlorooct-5-enoate (PubChem CID 101279434) has the molecular formula C8H12ClKO2
and a molecular weight of 214.73 g/mol. Its IUPAC name is potassium (E)-4-chlorooct-5-enoate.
Molecular Properties
| Compound Name | potassium (E)-4-chlorooct-5-enoate |
| PubChem CID | 101279434 |
| Molecular Formula | C8H12ClKO2 |
| Molecular Weight | 214.73 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | potassium (E)-4-chlorooct-5-enoate |
| SMILES | CC/C=C/C(Cl)CCC(=O)[O-].[K+] |
| InChI | InChI=1S/C8H13ClO2.K/c1-2-3-4-7(9)5-6-8(10)11;/h3-4,7H,2,5-6H2,1H3,(H,10,11);/q;+1/p-1/b4-3+; |
| InChIKey | ZWOOVGDGCUNXJC-BJILWQEISA-M |
| XLogP | -1.91 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.73 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze potassium (E)-4-chlorooct-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (E)-4-chlorooct-5-enoate?
The IUPAC name of potassium (E)-4-chlorooct-5-enoate (CID 101279434) is potassium (E)-4-chlorooct-5-enoate.
What is the SMILES notation for potassium (E)-4-chlorooct-5-enoate?
The canonical SMILES for potassium (E)-4-chlorooct-5-enoate is CC/C=C/C(Cl)CCC(=O)[O-].[K+].
What is the InChIKey of potassium (E)-4-chlorooct-5-enoate?
The InChIKey is ZWOOVGDGCUNXJC-BJILWQEISA-M. The full InChI is InChI=1S/C8H13ClO2.K/c1-2-3-4-7(9)5-6-8(10)11;/h3-4,7H,2,5-6H2,1H3,(H,10,11);/q;+1/p-1/b4-3+;.
What are the key properties of potassium (E)-4-chlorooct-5-enoate?
potassium (E)-4-chlorooct-5-enoate has a molecular weight of 214.73 g/mol, XLogP of -1.91, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (E)-4-chlorooct-5-enoate is sourced from PubChem (CID 101279434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).