C44H62CaO4 — CID 102375877
calcium bis((4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate) (PubChem CID 102375877) has the molecular formula C44H62CaO4 and a molecular weight of 695.05 g/mol. Its IUPAC name is calcium bis((4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate).
| Compound Name | calcium bis((4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate) |
|---|---|
| PubChem CID | 102375877 |
| Molecular Formula | C44H62CaO4 |
| Molecular Weight | 695.05 g/mol |
| Exact Mass | 694.43 |
| IUPAC Name | calcium bis((4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate) |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)[O-].CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C22H32O2.Ca/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;/h2*3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-21H2,1H3,(H,23,24);/q;;+2/p-2/b2*4-3-,7-6-,10-9-,13-12-,16-15-,19-18-; |
| InChIKey | JRJRIHQIQSJRRM-HOUGKSIUSA-L |
| XLogP | 10.05 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.05 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|