About 5-bromo-4,5,5-trifluoropentanoate
5-bromo-4,5,5-trifluoropentanoate (PubChem CID 154255993) has the molecular formula C5H5BrF3O2-
and a molecular weight of 233.99 g/mol. Its IUPAC name is 5-bromo-4,5,5-trifluoropentanoate.
Molecular Properties
| Compound Name | 5-bromo-4,5,5-trifluoropentanoate |
| PubChem CID | 154255993 |
| Molecular Formula | C5H5BrF3O2- |
| Molecular Weight | 233.99 g/mol |
| Exact Mass | 232.94 |
| IUPAC Name | 5-bromo-4,5,5-trifluoropentanoate |
| SMILES | O=C([O-])CCC(F)C(F)(F)Br |
| InChI | InChI=1S/C5H6BrF3O2/c6-5(8,9)3(7)1-2-4(10)11/h3H,1-2H2,(H,10,11)/p-1 |
| InChIKey | FJBKQETWAIUQGV-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.99 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-4,5,5-trifluoropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4,5,5-trifluoropentanoate?
The IUPAC name of 5-bromo-4,5,5-trifluoropentanoate (CID 154255993) is 5-bromo-4,5,5-trifluoropentanoate.
What is the SMILES notation for 5-bromo-4,5,5-trifluoropentanoate?
The canonical SMILES for 5-bromo-4,5,5-trifluoropentanoate is O=C([O-])CCC(F)C(F)(F)Br.
What is the InChIKey of 5-bromo-4,5,5-trifluoropentanoate?
The InChIKey is FJBKQETWAIUQGV-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H6BrF3O2/c6-5(8,9)3(7)1-2-4(10)11/h3H,1-2H2,(H,10,11)/p-1.
What are the key properties of 5-bromo-4,5,5-trifluoropentanoate?
5-bromo-4,5,5-trifluoropentanoate has a molecular weight of 233.99 g/mol, XLogP of 0.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4,5,5-trifluoropentanoate is sourced from PubChem (CID 154255993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).