C8H14N2O5S — CID 139449923
acetyl sulfate;1-ethyl-3-methylimidazol-3-ium (PubChem CID 139449923) has the molecular formula C8H14N2O5S and a molecular weight of 250.28 g/mol. Its IUPAC name is acetyl sulfate;1-ethyl-3-methylimidazol-3-ium.
| Compound Name | acetyl sulfate;1-ethyl-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 139449923 |
| Molecular Formula | C8H14N2O5S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | acetyl sulfate;1-ethyl-3-methylimidazol-3-ium |
| SMILES | CC(=O)OS(=O)(=O)[O-].CCn1cc[n+](C)c1 |
| InChI | InChI=1S/C6H11N2.C2H4O5S/c1-3-8-5-4-7(2)6-8;1-2(3)7-8(4,5)6/h4-6H,3H2,1-2H3;1H3,(H,4,5,6)/q+1;/p-1 |
| InChIKey | ORFGGWIWCARKIV-UHFFFAOYSA-M |
| XLogP | -0.66 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|