C27H22N2O6 — CID 18837778
N-(9,10-dioxoanthracen-1-yl)-2-[4-(morpholine-4-carbonyl)phenoxy]acetamide (PubChem CID 18837778) has the molecular formula C27H22N2O6 and a molecular weight of 470.48 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-[4-(morpholine-4-carbonyl)phenoxy]acetamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-[4-(morpholine-4-carbonyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 18837778 |
| Molecular Formula | C27H22N2O6 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-[4-(morpholine-4-carbonyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C(=O)N2CCOCC2)cc1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H22N2O6/c30-23(16-35-18-10-8-17(9-11-18)27(33)29-12-14-34-15-13-29)28-22-7-3-6-21-24(22)26(32)20-5-2-1-4-19(20)25(21)31/h1-11H,12-16H2,(H,28,30) |
| InChIKey | NLFODEKJUQRENB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|