C17H11ClN2O2S — CID 10154483
3-chloro-N-(8-oxo-14-thia-15-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-6-yl)propanamide (PubChem CID 10154483) has the molecular formula C17H11ClN2O2S and a molecular weight of 342.81 g/mol. Its IUPAC name is 3-chloro-N-(8-oxo-14-thia-15-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-6-yl)propanamide.
| Compound Name | 3-chloro-N-(8-oxo-14-thia-15-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-6-yl)propanamide |
|---|---|
| PubChem CID | 10154483 |
| Molecular Formula | C17H11ClN2O2S |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 3-chloro-N-(8-oxo-14-thia-15-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-6-yl)propanamide |
| SMILES | O=C(CCCl)Nc1cccc2c1C(=O)c1cccc3snc-2c13 |
| InChI | InChI=1S/C17H11ClN2O2S/c18-8-7-13(21)19-11-5-1-3-9-14(11)17(22)10-4-2-6-12-15(10)16(9)20-23-12/h1-6H,7-8H2,(H,19,21) |
| InChIKey | RQCCJQGOTSSUJM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|