C18H27N3O4 — CID 22210278
methyl 2-[[2-[(2-ethylphenyl)carbamoylamino]-3-methylbutanoyl]amino]propanoate (PubChem CID 22210278) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl 2-[[2-[(2-ethylphenyl)carbamoylamino]-3-methylbutanoyl]amino]propanoate.
| Compound Name | methyl 2-[[2-[(2-ethylphenyl)carbamoylamino]-3-methylbutanoyl]amino]propanoate |
|---|---|
| PubChem CID | 22210278 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | methyl 2-[[2-[(2-ethylphenyl)carbamoylamino]-3-methylbutanoyl]amino]propanoate |
| SMILES | CCc1ccccc1NC(=O)NC(C(=O)NC(C)C(=O)OC)C(C)C |
| InChI | InChI=1S/C18H27N3O4/c1-6-13-9-7-8-10-14(13)20-18(24)21-15(11(2)3)16(22)19-12(4)17(23)25-5/h7-12,15H,6H2,1-5H3,(H,19,22)(H2,20,21,24) |
| InChIKey | KXDRHSCANLFXMS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |