C23H16BrN4O3+ — CID 135505091
N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-pyridin-1-ium-4-ylquinoline-4-carboxamide (PubChem CID 135505091) has the molecular formula C23H16BrN4O3+ and a molecular weight of 476.31 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-pyridin-1-ium-4-ylquinoline-4-carboxamide.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-pyridin-1-ium-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 135505091 |
| Molecular Formula | C23H16BrN4O3+ |
| Molecular Weight | 476.31 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-pyridin-1-ium-4-ylquinoline-4-carboxamide |
| SMILES | O=C(NN=Cc1cc2c(cc1Br)OCO2)c1cc(-c2cc[nH+]cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H15BrN4O3/c24-18-11-22-21(30-13-31-22)9-15(18)12-26-28-23(29)17-10-20(14-5-7-25-8-6-14)27-19-4-2-1-3-16(17)19/h1-12H,13H2,(H,28,29)/p+1 |
| InChIKey | LTZCFLACQNSAON-UHFFFAOYSA-O |
| XLogP | 3.97 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|