C24H16BrN3O4 — CID 4506513
N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-hydroxyphenyl)quinoline-4-carboxamide (PubChem CID 4506513) has the molecular formula C24H16BrN3O4 and a molecular weight of 490.31 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-hydroxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-hydroxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4506513 |
| Molecular Formula | C24H16BrN3O4 |
| Molecular Weight | 490.31 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-hydroxyphenyl)quinoline-4-carboxamide |
| SMILES | O=C(NN=Cc1cc2c(cc1Br)OCO2)c1cc(-c2ccccc2O)nc2ccccc12 |
| InChI | InChI=1S/C24H16BrN3O4/c25-18-11-23-22(31-13-32-23)9-14(18)12-26-28-24(30)17-10-20(16-6-2-4-8-21(16)29)27-19-7-3-1-5-15(17)19/h1-12,29H,13H2,(H,28,30) |
| InChIKey | ASZYLTPQNIUTPF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|