C21H17N4OS+ — CID 135505093
N-[(3-methylthiophen-2-yl)methylideneamino]-2-pyridin-1-ium-4-ylquinoline-4-carboxamide (PubChem CID 135505093) has the molecular formula C21H17N4OS+ and a molecular weight of 373.46 g/mol. Its IUPAC name is N-[(3-methylthiophen-2-yl)methylideneamino]-2-pyridin-1-ium-4-ylquinoline-4-carboxamide.
| Compound Name | N-[(3-methylthiophen-2-yl)methylideneamino]-2-pyridin-1-ium-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 135505093 |
| Molecular Formula | C21H17N4OS+ |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[(3-methylthiophen-2-yl)methylideneamino]-2-pyridin-1-ium-4-ylquinoline-4-carboxamide |
| SMILES | Cc1ccsc1C=NNC(=O)c1cc(-c2cc[nH+]cc2)nc2ccccc12 |
| InChI | InChI=1S/C21H16N4OS/c1-14-8-11-27-20(14)13-23-25-21(26)17-12-19(15-6-9-22-10-7-15)24-18-5-3-2-4-16(17)18/h2-13H,1H3,(H,25,26)/p+1 |
| InChIKey | UJCXWNVXRNXTAK-UHFFFAOYSA-O |
| XLogP | 3.85 |
| TPSA | 68.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|