C26H18N4OS2 — CID 6882954
N-[(E)-thiophen-2-ylmethylideneamino]-2-[4-(thiophen-2-ylmethylideneamino)phenyl]quinoline-4-carboxamide (PubChem CID 6882954) has the molecular formula C26H18N4OS2 and a molecular weight of 466.59 g/mol. Its IUPAC name is N-[(E)-thiophen-2-ylmethylideneamino]-2-[4-(thiophen-2-ylmethylideneamino)phenyl]quinoline-4-carboxamide.
| Compound Name | N-[(E)-thiophen-2-ylmethylideneamino]-2-[4-(thiophen-2-ylmethylideneamino)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 6882954 |
| Molecular Formula | C26H18N4OS2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | N-[(E)-thiophen-2-ylmethylideneamino]-2-[4-(thiophen-2-ylmethylideneamino)phenyl]quinoline-4-carboxamide |
| SMILES | O=C(N/N=C/c1cccs1)c1cc(-c2ccc(/N=C/c3cccs3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C26H18N4OS2/c31-26(30-28-17-21-6-4-14-33-21)23-15-25(29-24-8-2-1-7-22(23)24)18-9-11-19(12-10-18)27-16-20-5-3-13-32-20/h1-17H,(H,30,31)/b27-16+,28-17+ |
| InChIKey | QGZLACFZPOOXRR-ODBZBXGJSA-N |
| XLogP | 6.54 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|